On Target OPRD_HUMAN 0.38554215/CHEMBL3326796
For the given ligand ttt, we have found in our database that, being scored 0.38554215, the most similar ligand is CHEMBL3326796. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL3326796 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | C[C@H]1CN(CC[C@H](O)C2CCCCC2)CC[C@@]1(C)c3ccccc3 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00000000 01000200 00100100 00010600 00080000 00000000 00000000 20000000 00000800 000808c0 08300000 50018000 00000002 00800000 00000000 000c0008 00000000 02000000 02c02000 00000201 00000100 18000010 01000080 00500010 00000001 80000000 00000000 10000000 00000000 0006000a 00020000 00002600 |