On Target HRH4_HUMAN 0.27884614/CHEMBL1934061
For the given ligand ttt, we have found in our database that, being scored 0.27884614, the most similar ligand is CHEMBL1934061. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL1934061 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | COCCC[C@H](N1CCC[C@@H]1C)c2ccc(cc2)c3ccc(CN4CCCCC4)cc3 |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00002000 01000000 00100102 00010700 00180000 00000010 00000000 22001000 00000900 000808c0 08300000 50018800 80000802 00200000 00000400 00080008 00820000 02000000 04400000 10000201 00000100 18008000 11000000 00500010 00000000 c0000000 00000200 90000040 00004300 00060002 20040000 00002e00 |