On Target BKRB2_HUMAN 0.32978722/CHEMBL109172
For the given ligand ttt, we have found in our database that, being scored 0.32978722, the most similar ligand is CHEMBL109172. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL109172 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CN1CCC2(CC1)N(CC3CCCCC3)CN(CC(=O)C)C2=O |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030000 01001400 00100000 04000c00 00000000 00000000 00000004 20002000 00200000 000001a0 00200000 50033000 06009002 00002001 80000000 00000000 00000000 00002000 02002040 00000201 00000100 30010610 00000001 02100018 00010000 00000000 00000000 10000000 08000000 00040011 201a4000 00802200 |