On Target CCR2_HUMAN 0.42592594/CHEMBL523054
For the given ligand ttt, we have found in our database that, being scored 0.42592594, the most similar ligand is CHEMBL523054. Check out the elaboration below.
| ttt (Given Ligand) | CHEMBL523054 (Similar Ligand) |
|---|---|
| C=C2CC13CC(=O)C4C6(C)CN(C)C5C1C(=O)C2CC3C45CC(O)C6O | CC(C)[C@@]1(CC[C@H](C1)NC2CCCOCC2)C(=O)NCc3cc(cc(c3)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00070000 01000000 00100000 00000400 00180000 00000000 00000000 20000400 00000040 00128080 00200000 50011000 0c00803a 01800000 00000400 00080008 00000000 00000000 02c12010 00000201 00000000 10000210 05000080 00100010 00001001 00000000 00000000 90001000 00000000 01040000 24020000 00802a00 | 00030040 018a0000 00100100 00010700 00180001 00000000 10000400 22001000 00200000 000008d0 00240000 40039002 0400881a 01880000 00000400 00081008 00a00000 02000000 00c02000 00000201 80000020 18008630 01000080 00500018 00000401 c0000000 08000200 90000000 00000300 01060001 20160000 00802a00 |