On Target NK1R_HUMAN 0.284153/CHEMBL420221
For the given ligand Y-1, we have found in our database that, being scored 0.284153, the most similar ligand is CHEMBL420221. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL420221 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CC(=O)NCCCCCOC[C@H]1O[C@@H](OCCc2c[nH]c3ccccc23)[C@H](OCc4ccccc4)[C@@H](OCc5ccccc5)[C@@H]1OCc6ccccc6 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 0000004a 01001800 80100100 40810710 802c1050 00004000 00002800 28000040 00602100 010828e0 08200004 40018000 00008802 03c10000 000c0040 022e900c 18800020 02000000 1560a400 00000201 40110020 18048628 25800000 88500018 00042400 80002000 08080000 34000020 00000200 00060003 40a40200 02000620 |