On Target GRM2_HUMAN 0.25142857/CHEMBL485176
For the given ligand Y-1, we have found in our database that, being scored 0.25142857, the most similar ligand is CHEMBL485176. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL485176 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | O=C1OC2(CCOCC2)CN1Cc3ccc(OCC4CCCCC4)cc3 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000008 01c05808 20100308 80010700 801810c0 02008000 02040000 22001000 00000200 010008c0 00200000 40008000 00808802 00800100 11001401 001a3008 10860000 02000000 03402800 00020201 80000020 18048c50 13000000 0040001c 00000400 c0001002 10220200 90200001 00000300 00060009 a0060000 00000a00 |