On Target OPRX_HUMAN 0.25462964/CHEMBL3581762
For the given ligand Y-1, we have found in our database that, being scored 0.25462964, the most similar ligand is CHEMBL3581762. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3581762 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | CO[C@]12CC[C@@]3(C[C@]1(C)[C@H](O)c4cocc4)[C@H]5Cc6ccc(O)c7O[C@@H]2[C@]3(CCN5CC8CC8)c67 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04001000 43200208 2018050a 00214700 00381061 c2000002 02005000 20200241 00026990 010818c0 0c380000 50818040 40804402 21b00080 11240021 520ca018 08800220 22058000 17482002 00020201 00000100 18200010 05004040 89580410 00000000 c0004001 00120610 1a800011 64000302 0007c80a 40020000 00002f40 |