On Target HRH1_HUMAN 0.22435898/CHEMBL2208424
For the given ligand Y-1, we have found in our database that, being scored 0.22435898, the most similar ligand is CHEMBL2208424. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL2208424 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | O[C@@H](CCN1CCC(CC1)Oc2ccc(Cl)c(Cl)c2)COc3cccc(c3)C#N |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04008000 41000008 20100108 00010700 00101020 02000000 92000000 20000000 00000000 008008c0 00200000 50018800 02800006 00000082 11200003 00082008 00600000 02000400 00c80000 00020201 00000000 18000100 05000480 08500010 00002001 80100000 00300200 10800000 00000200 00060400 00000000 00022a40 |