On Target HRH2_HUMAN 0/CHEMBL1086105
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1086105. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1086105 (Similar Ligand) |
|---|---|
| C | Cc1cc(OCCCN2CCc3nc[nH]c3C2)ccc1c4nc5c(C)c(F)ccc5[nH]4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1400000a 40000808 20100108 13050e10 04041060 02104030 02046000 08083001 00400180 10490a50 61218004 40008800 018000a2 00709080 01020441 020c200d 00220200 0a002022 80a80000 40420200 41020800 38210820 218050a0 10400010 01041001 81000600 00024040 80000003 04000204 00478c00 60000800 a00022e0 |