On Target ADA2A_HUMAN 0/CHEMBL1276219
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1276219. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1276219 (Similar Ligand) |
|---|---|
| C | C[C@@H](Oc1ccccc1C2CC2)C3=NCCN3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04002000 00000008 20300108 00012602 00001080 80010000 12000008 00000200 01010800 20080843 18310010 60008040 00900002 01000008 01101001 00182008 10000800 22128000 00000020 00020201 00200100 38040000 12000001 02400c10 00000080 c0000000 40000000 00000001 08040310 00068002 00000000 00000600 |